N-(2-acetamido-4-methoxy-1,3-benzothiazol-6-yl)-2-(4-fluorophenyl)acetamide
Chemical Structure Depiction of
N-(2-acetamido-4-methoxy-1,3-benzothiazol-6-yl)-2-(4-fluorophenyl)acetamide
N-(2-acetamido-4-methoxy-1,3-benzothiazol-6-yl)-2-(4-fluorophenyl)acetamide
Compound characteristics
| Compound ID: | F259-0574 |
| Compound Name: | N-(2-acetamido-4-methoxy-1,3-benzothiazol-6-yl)-2-(4-fluorophenyl)acetamide |
| Molecular Weight: | 373.4 |
| Molecular Formula: | C18 H16 F N3 O3 S |
| Smiles: | CC(Nc1nc2c(cc(cc2s1)NC(Cc1ccc(cc1)F)=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9812 |
| logD: | 2.98 |
| logSw: | -3.3011 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 64.54 |
| InChI Key: | GMBDMTCEOSPYDS-UHFFFAOYSA-N |