3-chloro-4-fluoro-N-{4-methyl-2-[(4-methylbenzene-1-sulfonyl)amino]-1,3-benzothiazol-6-yl}benzamide
Chemical Structure Depiction of
3-chloro-4-fluoro-N-{4-methyl-2-[(4-methylbenzene-1-sulfonyl)amino]-1,3-benzothiazol-6-yl}benzamide
3-chloro-4-fluoro-N-{4-methyl-2-[(4-methylbenzene-1-sulfonyl)amino]-1,3-benzothiazol-6-yl}benzamide
Compound characteristics
| Compound ID: | F260-0904 |
| Compound Name: | 3-chloro-4-fluoro-N-{4-methyl-2-[(4-methylbenzene-1-sulfonyl)amino]-1,3-benzothiazol-6-yl}benzamide |
| Molecular Weight: | 489.97 |
| Molecular Formula: | C22 H17 Cl F N3 O3 S2 |
| Smiles: | Cc1ccc(cc1)S(Nc1nc2c(C)cc(cc2s1)NC(c1ccc(c(c1)[Cl])F)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7472 |
| logD: | 5.0863 |
| logSw: | -6.0451 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.511 |
| InChI Key: | SWFWNUWJVXCTRO-UHFFFAOYSA-N |