N-[2-(4-methoxybenzoyl)-3-methyl-1-benzofuran-6-yl]thiophene-2-carboxamide
Chemical Structure Depiction of
N-[2-(4-methoxybenzoyl)-3-methyl-1-benzofuran-6-yl]thiophene-2-carboxamide
N-[2-(4-methoxybenzoyl)-3-methyl-1-benzofuran-6-yl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | F265-0116 |
| Compound Name: | N-[2-(4-methoxybenzoyl)-3-methyl-1-benzofuran-6-yl]thiophene-2-carboxamide |
| Molecular Weight: | 391.44 |
| Molecular Formula: | C22 H17 N O4 S |
| Smiles: | Cc1c2ccc(cc2oc1C(c1ccc(cc1)OC)=O)NC(c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3969 |
| logD: | 5.3969 |
| logSw: | -5.6481 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.885 |
| InChI Key: | KZNSZVGKIAYTMC-UHFFFAOYSA-N |