(5-amino-3-methyl-1-benzofuran-2-yl)(phenyl)methanone
Chemical Structure Depiction of
(5-amino-3-methyl-1-benzofuran-2-yl)(phenyl)methanone
(5-amino-3-methyl-1-benzofuran-2-yl)(phenyl)methanone
Compound characteristics
| Compound ID: | F267-0003 |
| Compound Name: | (5-amino-3-methyl-1-benzofuran-2-yl)(phenyl)methanone |
| Molecular Weight: | 251.28 |
| Molecular Formula: | C16 H13 N O2 |
| Smiles: | Cc1c2cc(ccc2oc1C(c1ccccc1)=O)N |
| Stereo: | ACHIRAL |
| logP: | 3.4137 |
| logD: | 3.4132 |
| logSw: | -3.761 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 43.037 |
| InChI Key: | UHDFYBINXOYFGI-UHFFFAOYSA-N |