N-[2-(2,5-dimethoxybenzoyl)-3-methyl-1-benzofuran-5-yl]-2-methylbenzamide
Chemical Structure Depiction of
N-[2-(2,5-dimethoxybenzoyl)-3-methyl-1-benzofuran-5-yl]-2-methylbenzamide
N-[2-(2,5-dimethoxybenzoyl)-3-methyl-1-benzofuran-5-yl]-2-methylbenzamide
Compound characteristics
| Compound ID: | F267-0221 |
| Compound Name: | N-[2-(2,5-dimethoxybenzoyl)-3-methyl-1-benzofuran-5-yl]-2-methylbenzamide |
| Molecular Weight: | 429.47 |
| Molecular Formula: | C26 H23 N O5 |
| Smiles: | Cc1ccccc1C(Nc1ccc2c(c1)c(C)c(C(c1cc(ccc1OC)OC)=O)o2)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5424 |
| logD: | 5.5407 |
| logSw: | -5.7216 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.497 |
| InChI Key: | LBADARSCRVVEJA-UHFFFAOYSA-N |