N-(2-fluorophenyl)-2-[4-(3-methoxyphenyl)-3-methyl-7-oxo[1,2]oxazolo[3,4-d]pyridazin-6(7H)-yl]butanamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-2-[4-(3-methoxyphenyl)-3-methyl-7-oxo[1,2]oxazolo[3,4-d]pyridazin-6(7H)-yl]butanamide
N-(2-fluorophenyl)-2-[4-(3-methoxyphenyl)-3-methyl-7-oxo[1,2]oxazolo[3,4-d]pyridazin-6(7H)-yl]butanamide
Compound characteristics
| Compound ID: | F279-0038 |
| Compound Name: | N-(2-fluorophenyl)-2-[4-(3-methoxyphenyl)-3-methyl-7-oxo[1,2]oxazolo[3,4-d]pyridazin-6(7H)-yl]butanamide |
| Molecular Weight: | 436.44 |
| Molecular Formula: | C23 H21 F N4 O4 |
| Smiles: | CCC(C(Nc1ccccc1F)=O)N1C(c2c(C(c3cccc(c3)OC)=N1)c(C)on2)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9403 |
| logD: | 3.9401 |
| logSw: | -4.2785 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.844 |
| InChI Key: | QAFLJYHDCAWSTD-SFHVURJKSA-N |