N-(4-fluorophenyl)-2-[4-(3-methoxyphenyl)-3-methyl-7-oxo[1,2]oxazolo[3,4-d]pyridazin-6(7H)-yl]propanamide
Chemical Structure Depiction of
N-(4-fluorophenyl)-2-[4-(3-methoxyphenyl)-3-methyl-7-oxo[1,2]oxazolo[3,4-d]pyridazin-6(7H)-yl]propanamide
N-(4-fluorophenyl)-2-[4-(3-methoxyphenyl)-3-methyl-7-oxo[1,2]oxazolo[3,4-d]pyridazin-6(7H)-yl]propanamide
Compound characteristics
| Compound ID: | F279-0134 |
| Compound Name: | N-(4-fluorophenyl)-2-[4-(3-methoxyphenyl)-3-methyl-7-oxo[1,2]oxazolo[3,4-d]pyridazin-6(7H)-yl]propanamide |
| Molecular Weight: | 422.41 |
| Molecular Formula: | C22 H19 F N4 O4 |
| Smiles: | CC(C(Nc1ccc(cc1)F)=O)N1C(c2c(C(c3cccc(c3)OC)=N1)c(C)on2)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.205 |
| logD: | 3.2049 |
| logSw: | -3.6846 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.957 |
| InChI Key: | ZDBNRDJMRRQTNW-LBPRGKRZSA-N |