4-(4-methoxyphenyl)-3-methyl-6-[(3-methylphenyl)methyl][1,2]oxazolo[3,4-d]pyridazin-7(6H)-one
Chemical Structure Depiction of
4-(4-methoxyphenyl)-3-methyl-6-[(3-methylphenyl)methyl][1,2]oxazolo[3,4-d]pyridazin-7(6H)-one
4-(4-methoxyphenyl)-3-methyl-6-[(3-methylphenyl)methyl][1,2]oxazolo[3,4-d]pyridazin-7(6H)-one
Compound characteristics
| Compound ID: | F279-0181 |
| Compound Name: | 4-(4-methoxyphenyl)-3-methyl-6-[(3-methylphenyl)methyl][1,2]oxazolo[3,4-d]pyridazin-7(6H)-one |
| Molecular Weight: | 361.4 |
| Molecular Formula: | C21 H19 N3 O3 |
| Smiles: | Cc1cccc(CN2C(c3c(C(c4ccc(cc4)OC)=N2)c(C)on3)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.7581 |
| logD: | 3.7531 |
| logSw: | -4.2325 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 57.062 |
| InChI Key: | RAEPJZZNHFVGGJ-UHFFFAOYSA-N |