4-(4-methoxyphenyl)-3-methyl-6-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl}[1,2]oxazolo[3,4-d]pyridazin-7(6H)-one
Chemical Structure Depiction of
4-(4-methoxyphenyl)-3-methyl-6-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl}[1,2]oxazolo[3,4-d]pyridazin-7(6H)-one
4-(4-methoxyphenyl)-3-methyl-6-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl}[1,2]oxazolo[3,4-d]pyridazin-7(6H)-one
Compound characteristics
| Compound ID: | F279-0234 |
| Compound Name: | 4-(4-methoxyphenyl)-3-methyl-6-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl}[1,2]oxazolo[3,4-d]pyridazin-7(6H)-one |
| Molecular Weight: | 442.47 |
| Molecular Formula: | C25 H22 N4 O4 |
| Smiles: | Cc1ccc(cc1)c1nc(CN2C(c3c(C(c4ccc(cc4)OC)=N2)c(C)on3)=O)c(C)o1 |
| Stereo: | ACHIRAL |
| logP: | 4.0701 |
| logD: | 4.0685 |
| logSw: | -4.3596 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 75.184 |
| InChI Key: | QLBHMEVAIGNKIB-UHFFFAOYSA-N |