6-{[2-(4-ethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-4-(4-methoxyphenyl)-3-methyl[1,2]oxazolo[3,4-d]pyridazin-7(6H)-one
Chemical Structure Depiction of
6-{[2-(4-ethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-4-(4-methoxyphenyl)-3-methyl[1,2]oxazolo[3,4-d]pyridazin-7(6H)-one
6-{[2-(4-ethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-4-(4-methoxyphenyl)-3-methyl[1,2]oxazolo[3,4-d]pyridazin-7(6H)-one
Compound characteristics
| Compound ID: | F279-0325 |
| Compound Name: | 6-{[2-(4-ethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-4-(4-methoxyphenyl)-3-methyl[1,2]oxazolo[3,4-d]pyridazin-7(6H)-one |
| Molecular Weight: | 472.5 |
| Molecular Formula: | C26 H24 N4 O5 |
| Smiles: | CCOc1ccc(cc1)c1nc(CN2C(c3c(C(c4ccc(cc4)OC)=N2)c(C)on3)=O)c(C)o1 |
| Stereo: | ACHIRAL |
| logP: | 4.0157 |
| logD: | 4.014 |
| logSw: | -4.3082 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 82.307 |
| InChI Key: | CAVXREUXLSWPES-UHFFFAOYSA-N |