N-(2,1,3-benzothiadiazol-4-yl)-8-methyl-2-phenylquinoline-4-carboxamide
Chemical Structure Depiction of
N-(2,1,3-benzothiadiazol-4-yl)-8-methyl-2-phenylquinoline-4-carboxamide
N-(2,1,3-benzothiadiazol-4-yl)-8-methyl-2-phenylquinoline-4-carboxamide
Compound characteristics
| Compound ID: | F281-0104 |
| Compound Name: | N-(2,1,3-benzothiadiazol-4-yl)-8-methyl-2-phenylquinoline-4-carboxamide |
| Molecular Weight: | 396.47 |
| Molecular Formula: | C23 H16 N4 O S |
| Smiles: | Cc1cccc2c(cc(c3ccccc3)nc12)C(Nc1cccc2c1nsn2)=O |
| Stereo: | ACHIRAL |
| logP: | 6.2201 |
| logD: | 6.2201 |
| logSw: | -5.7593 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.414 |
| InChI Key: | NQZIBGUCGAIMFO-UHFFFAOYSA-N |