N-(2,1,3-benzothiadiazol-4-yl)-3-fluoro-4-methylbenzamide
Chemical Structure Depiction of
N-(2,1,3-benzothiadiazol-4-yl)-3-fluoro-4-methylbenzamide
N-(2,1,3-benzothiadiazol-4-yl)-3-fluoro-4-methylbenzamide
Compound characteristics
| Compound ID: | F281-0119 |
| Compound Name: | N-(2,1,3-benzothiadiazol-4-yl)-3-fluoro-4-methylbenzamide |
| Molecular Weight: | 287.31 |
| Molecular Formula: | C14 H10 F N3 O S |
| Smiles: | Cc1ccc(cc1F)C(Nc1cccc2c1nsn2)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9195 |
| logD: | 3.8622 |
| logSw: | -4.0431 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.584 |
| InChI Key: | LLKOKYIZJNQCTI-UHFFFAOYSA-N |