ethyl 6-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-6H-thieno[2,3-b]pyrrole-5-carboxylate
Chemical Structure Depiction of
ethyl 6-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-6H-thieno[2,3-b]pyrrole-5-carboxylate
ethyl 6-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-6H-thieno[2,3-b]pyrrole-5-carboxylate
Compound characteristics
| Compound ID: | F285-0364 |
| Compound Name: | ethyl 6-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-6H-thieno[2,3-b]pyrrole-5-carboxylate |
| Molecular Weight: | 422.89 |
| Molecular Formula: | C19 H19 Cl N2 O5 S |
| Smiles: | CCOC(c1cc2ccsc2n1CC(Nc1cc(c(cc1OC)OC)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.044 |
| logD: | 4.0257 |
| logSw: | -4.3737 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.012 |
| InChI Key: | HUNIIWRCZCXHSK-UHFFFAOYSA-N |