methyl 6-[(4-ethenylphenyl)methyl]-6H-thieno[2,3-b]pyrrole-5-carboxylate
Chemical Structure Depiction of
methyl 6-[(4-ethenylphenyl)methyl]-6H-thieno[2,3-b]pyrrole-5-carboxylate
methyl 6-[(4-ethenylphenyl)methyl]-6H-thieno[2,3-b]pyrrole-5-carboxylate
Compound characteristics
| Compound ID: | F285-1147 |
| Compound Name: | methyl 6-[(4-ethenylphenyl)methyl]-6H-thieno[2,3-b]pyrrole-5-carboxylate |
| Molecular Weight: | 297.37 |
| Molecular Formula: | C17 H15 N O2 S |
| Smiles: | COC(c1cc2ccsc2n1Cc1ccc(C=C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2973 |
| logD: | 4.2973 |
| logSw: | -4.4064 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 22.7197 |
| InChI Key: | NWEWCUIRWDBIOR-UHFFFAOYSA-N |