methyl 6-[1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl]-6H-thieno[2,3-b]pyrrole-5-carboxylate
Chemical Structure Depiction of
methyl 6-[1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl]-6H-thieno[2,3-b]pyrrole-5-carboxylate
methyl 6-[1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl]-6H-thieno[2,3-b]pyrrole-5-carboxylate
Compound characteristics
| Compound ID: | F285-1230 |
| Compound Name: | methyl 6-[1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl]-6H-thieno[2,3-b]pyrrole-5-carboxylate |
| Molecular Weight: | 370.47 |
| Molecular Formula: | C20 H22 N2 O3 S |
| Smiles: | CC(C(Nc1c(C)cc(C)cc1C)=O)n1c(cc2ccsc12)C(=O)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8222 |
| logD: | 3.8221 |
| logSw: | -3.9715 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.382 |
| InChI Key: | RMTPSEOJANHEFF-AWEZNQCLSA-N |