methyl 6-(2-{[(3-fluorophenyl)methyl]amino}-2-oxoethyl)-6H-thieno[2,3-b]pyrrole-5-carboxylate
Chemical Structure Depiction of
methyl 6-(2-{[(3-fluorophenyl)methyl]amino}-2-oxoethyl)-6H-thieno[2,3-b]pyrrole-5-carboxylate
methyl 6-(2-{[(3-fluorophenyl)methyl]amino}-2-oxoethyl)-6H-thieno[2,3-b]pyrrole-5-carboxylate
Compound characteristics
| Compound ID: | F285-1815 |
| Compound Name: | methyl 6-(2-{[(3-fluorophenyl)methyl]amino}-2-oxoethyl)-6H-thieno[2,3-b]pyrrole-5-carboxylate |
| Molecular Weight: | 346.38 |
| Molecular Formula: | C17 H15 F N2 O3 S |
| Smiles: | COC(c1cc2ccsc2n1CC(NCc1cccc(c1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0319 |
| logD: | 3.0319 |
| logSw: | -3.465 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.191 |
| InChI Key: | QEUKXFDJMVSYLE-UHFFFAOYSA-N |