2-[4-(2-chlorophenyl)piperazin-1-yl]-5-[(2-methylbenzene-1-sulfonyl)amino]benzoic acid
Chemical Structure Depiction of
2-[4-(2-chlorophenyl)piperazin-1-yl]-5-[(2-methylbenzene-1-sulfonyl)amino]benzoic acid
2-[4-(2-chlorophenyl)piperazin-1-yl]-5-[(2-methylbenzene-1-sulfonyl)amino]benzoic acid
Compound characteristics
| Compound ID: | F290-0112 |
| Compound Name: | 2-[4-(2-chlorophenyl)piperazin-1-yl]-5-[(2-methylbenzene-1-sulfonyl)amino]benzoic acid |
| Molecular Weight: | 485.99 |
| Molecular Formula: | C24 H24 Cl N3 O4 S |
| Smiles: | Cc1ccccc1S(Nc1ccc(c(c1)C(O)=O)N1CCN(CC1)c1ccccc1[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2388 |
| logD: | 3.1232 |
| logSw: | -5.154 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.407 |
| InChI Key: | YJBDSXLKVZJQOE-UHFFFAOYSA-N |