2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-5-[(2-methylbenzene-1-sulfonyl)amino]benzoic acid
Chemical Structure Depiction of
2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-5-[(2-methylbenzene-1-sulfonyl)amino]benzoic acid
2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-5-[(2-methylbenzene-1-sulfonyl)amino]benzoic acid
Compound characteristics
| Compound ID: | F290-0283 |
| Compound Name: | 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-5-[(2-methylbenzene-1-sulfonyl)amino]benzoic acid |
| Molecular Weight: | 479.6 |
| Molecular Formula: | C26 H29 N3 O4 S |
| Smiles: | Cc1ccc(C)c(c1)N1CCN(CC1)c1ccc(cc1C(O)=O)NS(c1ccccc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7222 |
| logD: | 3.6065 |
| logSw: | -5.266 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.407 |
| InChI Key: | BVUZOOLXITYYTJ-UHFFFAOYSA-N |