5-[(5-fluoro-2-methylbenzene-1-sulfonyl)amino]-2-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid
Chemical Structure Depiction of
5-[(5-fluoro-2-methylbenzene-1-sulfonyl)amino]-2-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid
5-[(5-fluoro-2-methylbenzene-1-sulfonyl)amino]-2-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid
Compound characteristics
| Compound ID: | F290-0456 |
| Compound Name: | 5-[(5-fluoro-2-methylbenzene-1-sulfonyl)amino]-2-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid |
| Molecular Weight: | 499.56 |
| Molecular Formula: | C25 H26 F N3 O5 S |
| Smiles: | Cc1ccc(cc1S(Nc1ccc(c(c1)C(O)=O)N1CCN(CC1)c1ccc(cc1)OC)(=O)=O)F |
| Stereo: | ACHIRAL |
| logP: | 4.9077 |
| logD: | 2.792 |
| logSw: | -4.4705 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 83.252 |
| InChI Key: | GINJXEKOOMXNHT-UHFFFAOYSA-N |