4-[4-(2-fluorophenyl)piperazin-1-yl]-3-[(thiophene-2-sulfonyl)amino]benzoic acid--trifluoroacetic acid (1/1)
Chemical Structure Depiction of
4-[4-(2-fluorophenyl)piperazin-1-yl]-3-[(thiophene-2-sulfonyl)amino]benzoic acid--trifluoroacetic acid (1/1)
4-[4-(2-fluorophenyl)piperazin-1-yl]-3-[(thiophene-2-sulfonyl)amino]benzoic acid--trifluoroacetic acid (1/1)
Compound characteristics
| Compound ID: | F292-0469 |
| Compound Name: | 4-[4-(2-fluorophenyl)piperazin-1-yl]-3-[(thiophene-2-sulfonyl)amino]benzoic acid--trifluoroacetic acid (1/1) |
| Molecular Weight: | 575.56 |
| Molecular Formula: | C21 H20 F N3 O4 S2 |
| Salt: | CF3COOH |
| Smiles: | C1CN(CCN1c1ccc(cc1NS(c1cccs1)(=O)=O)C(O)=O)c1ccccc1F |
| Stereo: | ACHIRAL |
| logP: | 4.5321 |
| logD: | 2.5942 |
| logSw: | -4.2261 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.728 |
| InChI Key: | WQAWBRSSFTUGDJ-UHFFFAOYSA-N |