2-[bis(2-methylpropyl)amino]-5-[(5-fluoro-2-methylbenzene-1-sulfonyl)amino]benzoic acid--trifluoroacetic acid (1/1)
Chemical Structure Depiction of
2-[bis(2-methylpropyl)amino]-5-[(5-fluoro-2-methylbenzene-1-sulfonyl)amino]benzoic acid--trifluoroacetic acid (1/1)
2-[bis(2-methylpropyl)amino]-5-[(5-fluoro-2-methylbenzene-1-sulfonyl)amino]benzoic acid--trifluoroacetic acid (1/1)
Compound characteristics
| Compound ID: | F294-0585 |
| Compound Name: | 2-[bis(2-methylpropyl)amino]-5-[(5-fluoro-2-methylbenzene-1-sulfonyl)amino]benzoic acid--trifluoroacetic acid (1/1) |
| Molecular Weight: | 550.57 |
| Molecular Formula: | C22 H29 F N2 O4 S |
| Salt: | CF3COOH |
| Smiles: | CC(C)CN(CC(C)C)c1ccc(cc1C(O)=O)NS(c1cc(ccc1C)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6145 |
| logD: | 3.4989 |
| logSw: | -5.2604 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.282 |
| InChI Key: | DENQWXDHXPSJJR-UHFFFAOYSA-N |