3-[(2,5-dimethoxybenzene-1-sulfonyl)amino]-4-(4-methylpiperidin-1-yl)benzoic acid--trifluoroacetic acid (1/1)
Chemical Structure Depiction of
3-[(2,5-dimethoxybenzene-1-sulfonyl)amino]-4-(4-methylpiperidin-1-yl)benzoic acid--trifluoroacetic acid (1/1)
3-[(2,5-dimethoxybenzene-1-sulfonyl)amino]-4-(4-methylpiperidin-1-yl)benzoic acid--trifluoroacetic acid (1/1)
Compound characteristics
| Compound ID: | F295-0153 |
| Compound Name: | 3-[(2,5-dimethoxybenzene-1-sulfonyl)amino]-4-(4-methylpiperidin-1-yl)benzoic acid--trifluoroacetic acid (1/1) |
| Molecular Weight: | 548.53 |
| Molecular Formula: | C21 H26 N2 O6 S |
| Salt: | CF3COOH |
| Smiles: | CC1CCN(CC1)c1ccc(cc1NS(c1cc(ccc1OC)OC)(=O)=O)C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1121 |
| logD: | 1.8742 |
| logSw: | -4.1932 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 86.924 |
| InChI Key: | MQMKRTHALSNCFC-UHFFFAOYSA-N |