N-[(4-chlorophenyl)methyl]-1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide
					Chemical Structure Depiction of
N-[(4-chlorophenyl)methyl]-1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide
			N-[(4-chlorophenyl)methyl]-1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | F305-0168 | 
| Compound Name: | N-[(4-chlorophenyl)methyl]-1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide | 
| Molecular Weight: | 420.94 | 
| Molecular Formula: | C24 H25 Cl N4 O | 
| Smiles: | Cc1ccccc1c1ccc(nn1)N1CCCC(C1)C(NCc1ccc(cc1)[Cl])=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 4.1671 | 
| logD: | 4.1669 | 
| logSw: | -4.5751 | 
| Hydrogen bond acceptors count: | 4 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 48.972 | 
| InChI Key: | OAIMAAXYYDSCJG-IBGZPJMESA-N | 
 
				 
				