N-[(4-bromophenyl)methyl]-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-[(4-bromophenyl)methyl]-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide
N-[(4-bromophenyl)methyl]-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | F305-0770 |
| Compound Name: | N-[(4-bromophenyl)methyl]-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide |
| Molecular Weight: | 469.36 |
| Molecular Formula: | C23 H22 Br F N4 O |
| Smiles: | C1CN(CCC1C(NCc1ccc(cc1)[Br])=O)c1ccc(c2ccc(cc2)F)nn1 |
| Stereo: | ACHIRAL |
| logP: | 4.4826 |
| logD: | 4.4818 |
| logSw: | -4.4239 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.039 |
| InChI Key: | JSXQPETZTFCNBM-UHFFFAOYSA-N |