N-(3-chloro-4-methylphenyl)-1-[6-(3-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)-1-[6-(3-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide
N-(3-chloro-4-methylphenyl)-1-[6-(3-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | F305-1071 |
| Compound Name: | N-(3-chloro-4-methylphenyl)-1-[6-(3-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide |
| Molecular Weight: | 424.9 |
| Molecular Formula: | C23 H22 Cl F N4 O |
| Smiles: | Cc1ccc(cc1[Cl])NC(C1CCN(CC1)c1ccc(c2cccc(c2)F)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3201 |
| logD: | 5.3175 |
| logSw: | -5.9443 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.717 |
| InChI Key: | ZUYMJTLAFJNNAJ-UHFFFAOYSA-N |