3-[2-(2,4-dichlorophenyl)-1-methyl-1H-indol-3-yl]-2-[(furan-2-yl)methyl]-2,3-dihydro-1H-isoindol-1-one
Chemical Structure Depiction of
3-[2-(2,4-dichlorophenyl)-1-methyl-1H-indol-3-yl]-2-[(furan-2-yl)methyl]-2,3-dihydro-1H-isoindol-1-one
3-[2-(2,4-dichlorophenyl)-1-methyl-1H-indol-3-yl]-2-[(furan-2-yl)methyl]-2,3-dihydro-1H-isoindol-1-one
Compound characteristics
| Compound ID: | F313-3899 |
| Compound Name: | 3-[2-(2,4-dichlorophenyl)-1-methyl-1H-indol-3-yl]-2-[(furan-2-yl)methyl]-2,3-dihydro-1H-isoindol-1-one |
| Molecular Weight: | 487.38 |
| Molecular Formula: | C28 H20 Cl2 N2 O2 |
| Smiles: | Cn1c(c2ccc(cc2[Cl])[Cl])c(C2c3ccccc3C(N2Cc2ccco2)=O)c2ccccc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.9591 |
| logD: | 6.9591 |
| logSw: | -6.4427 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 24.8059 |
| InChI Key: | KKDBBSJAHJIRPI-MHZLTWQESA-N |