N-[4-(diethylamino)-2-methylphenyl]-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonamide
Chemical Structure Depiction of
N-[4-(diethylamino)-2-methylphenyl]-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonamide
N-[4-(diethylamino)-2-methylphenyl]-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F318-0582 |
| Compound Name: | N-[4-(diethylamino)-2-methylphenyl]-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonamide |
| Molecular Weight: | 434.58 |
| Molecular Formula: | C20 H26 N4 O3 S2 |
| Smiles: | CCc1nc(c2cc(c(C)s2)S(Nc2ccc(cc2C)N(CC)CC)(=O)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 5.0556 |
| logD: | 4.3158 |
| logSw: | -4.6926 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.288 |
| InChI Key: | GXXLFIANPSUWBT-UHFFFAOYSA-N |