N-[(4-chlorophenyl)methyl]-4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzamide
Chemical Structure Depiction of
N-[(4-chlorophenyl)methyl]-4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzamide
N-[(4-chlorophenyl)methyl]-4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzamide
Compound characteristics
| Compound ID: | F319-0426 |
| Compound Name: | N-[(4-chlorophenyl)methyl]-4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzamide |
| Molecular Weight: | 341.8 |
| Molecular Formula: | C18 H16 Cl N3 O2 |
| Smiles: | CCc1nc(c2ccc(cc2)C(NCc2ccc(cc2)[Cl])=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.2637 |
| logD: | 4.2636 |
| logSw: | -4.5274 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.995 |
| InChI Key: | QYRYHOXJKXBXQC-UHFFFAOYSA-N |