4-chloro-N-[3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]-2-methoxybenzamide
Chemical Structure Depiction of
4-chloro-N-[3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]-2-methoxybenzamide
4-chloro-N-[3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]-2-methoxybenzamide
Compound characteristics
| Compound ID: | F321-1325 |
| Compound Name: | 4-chloro-N-[3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]-2-methoxybenzamide |
| Molecular Weight: | 369.81 |
| Molecular Formula: | C19 H16 Cl N3 O3 |
| Smiles: | COc1cc(ccc1C(Nc1cccc(c1)c1nc(C2CC2)on1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.701 |
| logD: | 5.6946 |
| logSw: | -5.9611 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.889 |
| InChI Key: | FGUULHYGWRDFRE-UHFFFAOYSA-N |