N-(4-chlorophenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide
N-(4-chlorophenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F322-0031 |
| Compound Name: | N-(4-chlorophenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide |
| Molecular Weight: | 368.86 |
| Molecular Formula: | C15 H13 Cl N2 O3 S2 |
| Smiles: | Cc1c(c(c(C)s1)S(Nc1ccc(cc1)[Cl])(=O)=O)c1ccno1 |
| Stereo: | ACHIRAL |
| logP: | 3.828 |
| logD: | 3.2115 |
| logSw: | -4.8177 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.775 |
| InChI Key: | MWFJSFNJVHLRGH-UHFFFAOYSA-N |