N-(2-ethylphenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide
Chemical Structure Depiction of
N-(2-ethylphenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide
N-(2-ethylphenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F322-0053 |
| Compound Name: | N-(2-ethylphenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide |
| Molecular Weight: | 362.47 |
| Molecular Formula: | C17 H18 N2 O3 S2 |
| Smiles: | CCc1ccccc1NS(c1c(c2ccno2)c(C)sc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8688 |
| logD: | 3.8556 |
| logSw: | -4.0681 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.077 |
| InChI Key: | FZZRRCCQKHCSAL-UHFFFAOYSA-N |