N-(3-chloro-4-methoxyphenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide
Chemical Structure Depiction of
N-(3-chloro-4-methoxyphenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide
N-(3-chloro-4-methoxyphenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F322-0161 |
| Compound Name: | N-(3-chloro-4-methoxyphenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide |
| Molecular Weight: | 398.88 |
| Molecular Formula: | C16 H15 Cl N2 O4 S2 |
| Smiles: | Cc1c(c(c(C)s1)S(Nc1ccc(c(c1)[Cl])OC)(=O)=O)c1ccno1 |
| Stereo: | ACHIRAL |
| logP: | 3.7108 |
| logD: | 2.7572 |
| logSw: | -4.5916 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.406 |
| InChI Key: | AILZSXOHUUTCOE-UHFFFAOYSA-N |