N-(2-methoxyphenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide
Chemical Structure Depiction of
N-(2-methoxyphenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide
N-(2-methoxyphenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F322-0221 |
| Compound Name: | N-(2-methoxyphenyl)-2,5-dimethyl-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide |
| Molecular Weight: | 364.44 |
| Molecular Formula: | C16 H16 N2 O4 S2 |
| Smiles: | Cc1c(c(c(C)s1)S(Nc1ccccc1OC)(=O)=O)c1ccno1 |
| Stereo: | ACHIRAL |
| logP: | 2.9989 |
| logD: | 2.6191 |
| logSw: | -3.4999 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.708 |
| InChI Key: | WJMPKMMRVCCBQG-UHFFFAOYSA-N |