N-(4-ethoxyphenyl)-2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
N-(4-ethoxyphenyl)-2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F322-0465 |
| Compound Name: | N-(4-ethoxyphenyl)-2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide |
| Molecular Weight: | 392.49 |
| Molecular Formula: | C18 H20 N2 O4 S2 |
| Smiles: | CCOc1ccc(cc1)NS(c1c(c2cc(C)no2)c(C)sc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2624 |
| logD: | 4.2188 |
| logSw: | -4.3255 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.372 |
| InChI Key: | PNIGHWUGRKXDQY-UHFFFAOYSA-N |