N-(4-bromo-3-methylphenyl)-2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
Chemical Structure Depiction of
N-(4-bromo-3-methylphenyl)-2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
N-(4-bromo-3-methylphenyl)-2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F322-0525 |
| Compound Name: | N-(4-bromo-3-methylphenyl)-2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide |
| Molecular Weight: | 441.36 |
| Molecular Formula: | C17 H17 Br N2 O3 S2 |
| Smiles: | Cc1cc(ccc1[Br])NS(c1c(c2cc(C)no2)c(C)sc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0349 |
| logD: | 4.5485 |
| logSw: | -4.8925 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.248 |
| InChI Key: | UIMRMTUTVJMBAD-UHFFFAOYSA-N |