N-(2-ethyl-6-methylphenyl)-2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
Chemical Structure Depiction of
N-(2-ethyl-6-methylphenyl)-2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
N-(2-ethyl-6-methylphenyl)-2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F322-0527 |
| Compound Name: | N-(2-ethyl-6-methylphenyl)-2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide |
| Molecular Weight: | 390.52 |
| Molecular Formula: | C19 H22 N2 O3 S2 |
| Smiles: | CCc1cccc(C)c1NS(c1c(c2cc(C)no2)c(C)sc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5597 |
| logD: | 4.537 |
| logSw: | -4.463 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.852 |
| InChI Key: | KMLOXDQXBARDBP-UHFFFAOYSA-N |