2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)-N-(naphthalen-1-yl)thiophene-3-sulfonamide
Chemical Structure Depiction of
2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)-N-(naphthalen-1-yl)thiophene-3-sulfonamide
2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)-N-(naphthalen-1-yl)thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F322-0602 |
| Compound Name: | 2,5-dimethyl-4-(3-methyl-1,2-oxazol-5-yl)-N-(naphthalen-1-yl)thiophene-3-sulfonamide |
| Molecular Weight: | 398.5 |
| Molecular Formula: | C20 H18 N2 O3 S2 |
| Smiles: | Cc1cc(c2c(c(C)sc2C)S(Nc2cccc3ccccc23)(=O)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.714 |
| logD: | 4.614 |
| logSw: | -5.4982 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.279 |
| InChI Key: | ISOHAPOKXJAREL-UHFFFAOYSA-N |