N-(4-bromo-2-fluorophenyl)-4-(3,4-dimethyl-1,2-oxazol-5-yl)-2,5-dimethylthiophene-3-sulfonamide
Chemical Structure Depiction of
N-(4-bromo-2-fluorophenyl)-4-(3,4-dimethyl-1,2-oxazol-5-yl)-2,5-dimethylthiophene-3-sulfonamide
N-(4-bromo-2-fluorophenyl)-4-(3,4-dimethyl-1,2-oxazol-5-yl)-2,5-dimethylthiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F322-0864 |
| Compound Name: | N-(4-bromo-2-fluorophenyl)-4-(3,4-dimethyl-1,2-oxazol-5-yl)-2,5-dimethylthiophene-3-sulfonamide |
| Molecular Weight: | 459.35 |
| Molecular Formula: | C17 H16 Br F N2 O3 S2 |
| Smiles: | Cc1c(C)noc1c1c(c(C)sc1C)S(Nc1ccc(cc1F)[Br])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1392 |
| logD: | 2.7561 |
| logSw: | -5.3085 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.554 |
| InChI Key: | PBUAMKJGTZKKOM-UHFFFAOYSA-N |