4-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-ethoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide
					Chemical Structure Depiction of
4-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-ethoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide
			4-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-ethoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F322-0950 | 
| Compound Name: | 4-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-ethoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide | 
| Molecular Weight: | 406.52 | 
| Molecular Formula: | C19 H22 N2 O4 S2 | 
| Smiles: | CCOc1ccccc1NS(c1c(c2c(C)c(C)no2)c(C)sc1C)(=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.4881 | 
| logD: | 4.1203 | 
| logSw: | -4.4089 | 
| Hydrogen bond acceptors count: | 7 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 70.764 | 
| InChI Key: | ZBLZRYWCNGCRJV-UHFFFAOYSA-N | 
 
				 
				