N-benzyl-2-[3,3-dimethyl-5-(4-methylpiperidine-1-sulfonyl)-2-oxo-2,3-dihydro-1H-indol-1-yl]acetamide
Chemical Structure Depiction of
N-benzyl-2-[3,3-dimethyl-5-(4-methylpiperidine-1-sulfonyl)-2-oxo-2,3-dihydro-1H-indol-1-yl]acetamide
N-benzyl-2-[3,3-dimethyl-5-(4-methylpiperidine-1-sulfonyl)-2-oxo-2,3-dihydro-1H-indol-1-yl]acetamide
Compound characteristics
| Compound ID: | F323-0996 |
| Compound Name: | N-benzyl-2-[3,3-dimethyl-5-(4-methylpiperidine-1-sulfonyl)-2-oxo-2,3-dihydro-1H-indol-1-yl]acetamide |
| Molecular Weight: | 469.6 |
| Molecular Formula: | C25 H31 N3 O4 S |
| Smiles: | CC1CCN(CC1)S(c1ccc2c(c1)C(C)(C)C(N2CC(NCc1ccccc1)=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6536 |
| logD: | 3.6536 |
| logSw: | -3.9341 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.89 |
| InChI Key: | OTQXBMUJSVAHSX-UHFFFAOYSA-N |