N-(2,5-diethoxyphenyl)-2-(3,3-dimethyl-2-oxo-2,3-dihydro-1H-indol-1-yl)acetamide
Chemical Structure Depiction of
N-(2,5-diethoxyphenyl)-2-(3,3-dimethyl-2-oxo-2,3-dihydro-1H-indol-1-yl)acetamide
N-(2,5-diethoxyphenyl)-2-(3,3-dimethyl-2-oxo-2,3-dihydro-1H-indol-1-yl)acetamide
Compound characteristics
| Compound ID: | F324-0185 |
| Compound Name: | N-(2,5-diethoxyphenyl)-2-(3,3-dimethyl-2-oxo-2,3-dihydro-1H-indol-1-yl)acetamide |
| Molecular Weight: | 382.46 |
| Molecular Formula: | C22 H26 N2 O4 |
| Smiles: | CCOc1ccc(c(c1)NC(CN1C(C(C)(C)c2ccccc12)=O)=O)OCC |
| Stereo: | ACHIRAL |
| logP: | 3.7031 |
| logD: | 3.7022 |
| logSw: | -3.9715 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.493 |
| InChI Key: | ZOVQLEPSWHSCAH-UHFFFAOYSA-N |