2-(5-chloro-3,3-dimethyl-2-oxo-2,3-dihydro-1H-indol-1-yl)-N-cyclohexylacetamide
Chemical Structure Depiction of
2-(5-chloro-3,3-dimethyl-2-oxo-2,3-dihydro-1H-indol-1-yl)-N-cyclohexylacetamide
2-(5-chloro-3,3-dimethyl-2-oxo-2,3-dihydro-1H-indol-1-yl)-N-cyclohexylacetamide
Compound characteristics
| Compound ID: | F324-0826 |
| Compound Name: | 2-(5-chloro-3,3-dimethyl-2-oxo-2,3-dihydro-1H-indol-1-yl)-N-cyclohexylacetamide |
| Molecular Weight: | 334.84 |
| Molecular Formula: | C18 H23 Cl N2 O2 |
| Smiles: | CC1(C)C(N(CC(NC2CCCCC2)=O)c2ccc(cc12)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.76 |
| logD: | 3.76 |
| logSw: | -4.1632 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.904 |
| InChI Key: | YOWQLQUHEWHSHD-UHFFFAOYSA-N |