2-[1-(benzenesulfonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide
Chemical Structure Depiction of
2-[1-(benzenesulfonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide
2-[1-(benzenesulfonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide
Compound characteristics
| Compound ID: | F343-0093 |
| Compound Name: | 2-[1-(benzenesulfonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide |
| Molecular Weight: | 340.44 |
| Molecular Formula: | C16 H24 N2 O4 S |
| Smiles: | [H]c1ccc(cc1)S(N1CCC(CC1)CC(NCCOC)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.306 |
| logD: | 1.306 |
| logSw: | -2.3725 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.605 |
| InChI Key: | YHLUQWBOQOSHQS-UHFFFAOYSA-N |