N-[(4-ethylphenyl)methyl]-2-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]acetamide
Chemical Structure Depiction of
N-[(4-ethylphenyl)methyl]-2-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]acetamide
N-[(4-ethylphenyl)methyl]-2-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]acetamide
Compound characteristics
| Compound ID: | F344-0724 |
| Compound Name: | N-[(4-ethylphenyl)methyl]-2-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]acetamide |
| Molecular Weight: | 454.57 |
| Molecular Formula: | C26 H34 N2 O5 |
| Smiles: | CCc1ccc(CNC(CC2CCN(CC2)C(c2cc(c(c(c2)OC)OC)OC)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.4738 |
| logD: | 3.4738 |
| logSw: | -3.5908 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.064 |
| InChI Key: | VBNMBQHTFWPVHY-UHFFFAOYSA-N |