N-cyclohexyl-4-[2-({[4-(dimethylamino)phenyl]methyl}amino)-2-oxoethyl]piperidine-1-carboxamide
Chemical Structure Depiction of
N-cyclohexyl-4-[2-({[4-(dimethylamino)phenyl]methyl}amino)-2-oxoethyl]piperidine-1-carboxamide
N-cyclohexyl-4-[2-({[4-(dimethylamino)phenyl]methyl}amino)-2-oxoethyl]piperidine-1-carboxamide
Compound characteristics
| Compound ID: | F345-0619 |
| Compound Name: | N-cyclohexyl-4-[2-({[4-(dimethylamino)phenyl]methyl}amino)-2-oxoethyl]piperidine-1-carboxamide |
| Molecular Weight: | 400.56 |
| Molecular Formula: | C23 H36 N4 O2 |
| Smiles: | CN(C)c1ccc(CNC(CC2CCN(CC2)C(NC2CCCCC2)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.6049 |
| logD: | 3.5895 |
| logSw: | -3.699 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.76 |
| InChI Key: | DGEGDKWIHHMXPI-UHFFFAOYSA-N |