4-(2-{[(2-chlorophenyl)methyl]amino}-2-oxoethyl)-N-(4-methylphenyl)piperidine-1-carboxamide
Chemical Structure Depiction of
4-(2-{[(2-chlorophenyl)methyl]amino}-2-oxoethyl)-N-(4-methylphenyl)piperidine-1-carboxamide
4-(2-{[(2-chlorophenyl)methyl]amino}-2-oxoethyl)-N-(4-methylphenyl)piperidine-1-carboxamide
Compound characteristics
| Compound ID: | F345-0950 |
| Compound Name: | 4-(2-{[(2-chlorophenyl)methyl]amino}-2-oxoethyl)-N-(4-methylphenyl)piperidine-1-carboxamide |
| Molecular Weight: | 399.92 |
| Molecular Formula: | C22 H26 Cl N3 O2 |
| Smiles: | Cc1ccc(cc1)NC(N1CCC(CC1)CC(NCc1ccccc1[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3939 |
| logD: | 4.3939 |
| logSw: | -4.3074 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.908 |
| InChI Key: | BXGQTWBBGVEHRD-UHFFFAOYSA-N |