N-(4-methoxyphenyl)-4-(2-{[(2-methylphenyl)methyl]amino}-2-oxoethyl)piperidine-1-carboxamide
Chemical Structure Depiction of
N-(4-methoxyphenyl)-4-(2-{[(2-methylphenyl)methyl]amino}-2-oxoethyl)piperidine-1-carboxamide
N-(4-methoxyphenyl)-4-(2-{[(2-methylphenyl)methyl]amino}-2-oxoethyl)piperidine-1-carboxamide
Compound characteristics
| Compound ID: | F345-1185 |
| Compound Name: | N-(4-methoxyphenyl)-4-(2-{[(2-methylphenyl)methyl]amino}-2-oxoethyl)piperidine-1-carboxamide |
| Molecular Weight: | 395.5 |
| Molecular Formula: | C23 H29 N3 O3 |
| Smiles: | Cc1ccccc1CNC(CC1CCN(CC1)C(Nc1ccc(cc1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0588 |
| logD: | 4.0588 |
| logSw: | -4.1868 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.451 |
| InChI Key: | PBDAJUSUBIMNJY-UHFFFAOYSA-N |