ethyl 5-{[N-benzyl(2-methoxyphenyl)carbamamido]methyl}-2,4-dimethyl-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 5-{[N-benzyl(2-methoxyphenyl)carbamamido]methyl}-2,4-dimethyl-1H-pyrrole-3-carboxylate
ethyl 5-{[N-benzyl(2-methoxyphenyl)carbamamido]methyl}-2,4-dimethyl-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | F346-0069 |
| Compound Name: | ethyl 5-{[N-benzyl(2-methoxyphenyl)carbamamido]methyl}-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 435.52 |
| Molecular Formula: | C25 H29 N3 O4 |
| Smiles: | CCOC(c1c(C)c(CN(Cc2ccccc2)C(Nc2ccccc2OC)=O)[nH]c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5085 |
| logD: | 4.5085 |
| logSw: | -4.4781 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 64.162 |
| InChI Key: | LMGPAORNBMCMMO-UHFFFAOYSA-N |