N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methyl-2-oxoquinoxalin-1(2H)-yl)acetamide
Chemical Structure Depiction of
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methyl-2-oxoquinoxalin-1(2H)-yl)acetamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methyl-2-oxoquinoxalin-1(2H)-yl)acetamide
Compound characteristics
| Compound ID: | F354-0024 |
| Compound Name: | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methyl-2-oxoquinoxalin-1(2H)-yl)acetamide |
| Molecular Weight: | 381.43 |
| Molecular Formula: | C21 H23 N3 O4 |
| Smiles: | CC1C(N(CC(NCCc2ccc(c(c2)OC)OC)=O)c2ccccc2N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.2843 |
| logD: | 1.2843 |
| logSw: | -2.2669 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.197 |
| InChI Key: | OPLXOAHLPKITCI-UHFFFAOYSA-N |