2-(3-methyl-2-oxoquinoxalin-1(2H)-yl)-N-[2-(thiophen-2-yl)ethyl]acetamide
Chemical Structure Depiction of
2-(3-methyl-2-oxoquinoxalin-1(2H)-yl)-N-[2-(thiophen-2-yl)ethyl]acetamide
2-(3-methyl-2-oxoquinoxalin-1(2H)-yl)-N-[2-(thiophen-2-yl)ethyl]acetamide
Compound characteristics
| Compound ID: | F354-0203 |
| Compound Name: | 2-(3-methyl-2-oxoquinoxalin-1(2H)-yl)-N-[2-(thiophen-2-yl)ethyl]acetamide |
| Molecular Weight: | 327.4 |
| Molecular Formula: | C17 H17 N3 O2 S |
| Smiles: | CC1C(N(CC(NCCc2cccs2)=O)c2ccccc2N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.7263 |
| logD: | 1.7263 |
| logSw: | -2.3682 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.954 |
| InChI Key: | KJNXIBKVWFXUQZ-UHFFFAOYSA-N |